C21H21ClN3O2S+ — CID 7258590
3-chloro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 7258590) has the molecular formula C21H21ClN3O2S+ and a molecular weight of 414.94 g/mol. Its IUPAC name is 3-chloro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7258590 |
| Molecular Formula | C21H21ClN3O2S+ |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-chloro-N-[2-(4-methylpiperazin-4-ium-1-carbonyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | C[NH+]1CCN(C(=O)c2ccccc2NC(=O)c2sc3ccccc3c2Cl)CC1 |
| InChI | InChI=1S/C21H20ClN3O2S/c1-24-10-12-25(13-11-24)21(27)14-6-2-4-8-16(14)23-20(26)19-18(22)15-7-3-5-9-17(15)28-19/h2-9H,10-13H2,1H3,(H,23,26)/p+1 |
| InChIKey | WCSYYNPFWFYLRS-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |