C19H15ClN2O2S — CID 3161672
3-chloro-N-[2-(prop-2-enylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide (PubChem CID 3161672) has the molecular formula C19H15ClN2O2S and a molecular weight of 370.86 g/mol. Its IUPAC name is 3-chloro-N-[2-(prop-2-enylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[2-(prop-2-enylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 3161672 |
| Molecular Formula | C19H15ClN2O2S |
| Molecular Weight | 370.86 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 3-chloro-N-[2-(prop-2-enylcarbamoyl)phenyl]-1-benzothiophene-2-carboxamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C19H15ClN2O2S/c1-2-11-21-18(23)12-7-3-5-9-14(12)22-19(24)17-16(20)13-8-4-6-10-15(13)25-17/h2-10H,1,11H2,(H,21,23)(H,22,24) |
| InChIKey | RGLVBMQSSPQWKD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|