C21H20ClN3O2S2 — CID 17149452
N-[[2-(butylcarbamoyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide (PubChem CID 17149452) has the molecular formula C21H20ClN3O2S2 and a molecular weight of 446.00 g/mol. Its IUPAC name is N-[[2-(butylcarbamoyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(butylcarbamoyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17149452 |
| Molecular Formula | C21H20ClN3O2S2 |
| Molecular Weight | 446.00 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[[2-(butylcarbamoyl)phenyl]carbamothioyl]-3-chloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1ccccc1NC(=S)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C21H20ClN3O2S2/c1-2-3-12-23-19(26)13-8-4-6-10-15(13)24-21(28)25-20(27)18-17(22)14-9-5-7-11-16(14)29-18/h4-11H,2-3,12H2,1H3,(H,23,26)(H2,24,25,27,28) |
| InChIKey | YTOZXNOFHJFLRK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.00 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|