C17H10ClN2O3S2- — CID 7428387
2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylamino]benzoate (PubChem CID 7428387) has the molecular formula C17H10ClN2O3S2- and a molecular weight of 389.87 g/mol. Its IUPAC name is 2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylamino]benzoate.
| Compound Name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 7428387 |
| Molecular Formula | C17H10ClN2O3S2- |
| Molecular Weight | 389.87 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)carbamothioylamino]benzoate |
| SMILES | O=C([O-])c1ccccc1NC(=S)NC(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C17H11ClN2O3S2/c18-13-10-6-2-4-8-12(10)25-14(13)15(21)20-17(24)19-11-7-3-1-5-9(11)16(22)23/h1-8H,(H,22,23)(H2,19,20,21,24)/p-1 |
| InChIKey | GSLFEOPNVXJHNJ-UHFFFAOYSA-M |
| XLogP | 3.05 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.87 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|