C21H14BrCl2N3O3 — CID 126004546
4-bromo-N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 126004546) has the molecular formula C21H14BrCl2N3O3 and a molecular weight of 507.17 g/mol. Its IUPAC name is 4-bromo-N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-bromo-N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 126004546 |
| Molecular Formula | C21H14BrCl2N3O3 |
| Molecular Weight | 507.17 g/mol |
| Exact Mass | 504.96 |
| IUPAC Name | 4-bromo-N-[2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NNC(=O)c1ccc(Cl)cc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H14BrCl2N3O3/c22-13-7-5-12(6-8-13)19(28)25-18-4-2-1-3-16(18)21(30)27-26-20(29)15-10-9-14(23)11-17(15)24/h1-11H,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | PGTWDPMBVAAWSB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.17 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|