C19H23NO4S — CID 9088020
5-acetyl-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide (PubChem CID 9088020) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is 5-acetyl-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9088020 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5-acetyl-N-(3,4-dipropoxyphenyl)thiophene-2-carboxamide |
| SMILES | CCCOc1ccc(NC(=O)c2ccc(C(C)=O)s2)cc1OCCC |
| InChI | InChI=1S/C19H23NO4S/c1-4-10-23-15-7-6-14(12-16(15)24-11-5-2)20-19(22)18-9-8-17(25-18)13(3)21/h6-9,12H,4-5,10-11H2,1-3H3,(H,20,22) |
| InChIKey | NYOURDFOOZQZKU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |