C13H9Cl2NO2S — CID 9071635
5-acetyl-N-(3,4-dichlorophenyl)thiophene-2-carboxamide (PubChem CID 9071635) has the molecular formula C13H9Cl2NO2S and a molecular weight of 314.19 g/mol. Its IUPAC name is 5-acetyl-N-(3,4-dichlorophenyl)thiophene-2-carboxamide.
| Compound Name | 5-acetyl-N-(3,4-dichlorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9071635 |
| Molecular Formula | C13H9Cl2NO2S |
| Molecular Weight | 314.19 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 5-acetyl-N-(3,4-dichlorophenyl)thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(C(=O)Nc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C13H9Cl2NO2S/c1-7(17)11-4-5-12(19-11)13(18)16-8-2-3-9(14)10(15)6-8/h2-6H,1H3,(H,16,18) |
| InChIKey | BHAHMDYJQWCONA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |