C18H17ClN2O3S2 — CID 47516911
4-(5-chlorothiophen-2-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-3-carboxamide (PubChem CID 47516911) has the molecular formula C18H17ClN2O3S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 47516911 |
| Molecular Formula | C18H17ClN2O3S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]-1H-pyrrole-3-carboxamide |
| SMILES | CC(NC(=O)c1c[nH]cc1-c1ccc(Cl)s1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H17ClN2O3S2/c1-11(12-3-5-13(6-4-12)26(2,23)24)21-18(22)15-10-20-9-14(15)16-7-8-17(19)25-16/h3-11,20H,1-2H3,(H,21,22) |
| InChIKey | WCTTZWNOWLHWBD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |