C15H17ClN2O3S — CID 119363106
(2R)-2-[[4-(5-chlorothiophen-2-yl)-1H-pyrrole-3-carbonyl]amino]-4-methylpentanoic acid (PubChem CID 119363106) has the molecular formula C15H17ClN2O3S and a molecular weight of 340.83 g/mol. Its IUPAC name is (2R)-2-[[4-(5-chlorothiophen-2-yl)-1H-pyrrole-3-carbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[4-(5-chlorothiophen-2-yl)-1H-pyrrole-3-carbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119363106 |
| Molecular Formula | C15H17ClN2O3S |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | (2R)-2-[[4-(5-chlorothiophen-2-yl)-1H-pyrrole-3-carbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)c1c[nH]cc1-c1ccc(Cl)s1)C(=O)O |
| InChI | InChI=1S/C15H17ClN2O3S/c1-8(2)5-11(15(20)21)18-14(19)10-7-17-6-9(10)12-3-4-13(16)22-12/h3-4,6-8,11,17H,5H2,1-2H3,(H,18,19)(H,20,21)/t11-/m1/s1 |
| InChIKey | MJDPKHFFSJKHIS-LLVKDONJSA-N |
| XLogP | 3.63 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |