C15H12Cl4N2O3S — CID 26468278
3,4,5,6-tetrachloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]pyridine-2-carboxamide (PubChem CID 26468278) has the molecular formula C15H12Cl4N2O3S and a molecular weight of 442.15 g/mol. Its IUPAC name is 3,4,5,6-tetrachloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]pyridine-2-carboxamide.
| Compound Name | 3,4,5,6-tetrachloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 26468278 |
| Molecular Formula | C15H12Cl4N2O3S |
| Molecular Weight | 442.15 g/mol |
| Exact Mass | 439.93 |
| IUPAC Name | 3,4,5,6-tetrachloro-N-[(1R)-1-(4-methylsulfonylphenyl)ethyl]pyridine-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1nc(Cl)c(Cl)c(Cl)c1Cl)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H12Cl4N2O3S/c1-7(8-3-5-9(6-4-8)25(2,23)24)20-15(22)13-11(17)10(16)12(18)14(19)21-13/h3-7H,1-2H3,(H,20,22)/t7-/m1/s1 |
| InChIKey | DVYHZSOKOQOVDB-SSDOTTSWSA-N |
| XLogP | 4.59 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.15 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|