C19H25NO3S2 — CID 55433085
4-ethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propylthiophene-2-carboxamide (PubChem CID 55433085) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-ethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propylthiophene-2-carboxamide.
| Compound Name | 4-ethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55433085 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4-ethyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propylthiophene-2-carboxamide |
| SMILES | CCCc1sc(C(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)cc1CC |
| InChI | InChI=1S/C19H25NO3S2/c1-5-7-17-14(6-2)12-18(24-17)19(21)20-13(3)15-8-10-16(11-9-15)25(4,22)23/h8-13H,5-7H2,1-4H3,(H,20,21) |
| InChIKey | WHQYQSUYFWDAJE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |