C18H24N2O3S2 — CID 55333294
4-ethyl-5-propyl-N-[1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 55333294) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-ethyl-5-propyl-N-[1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 4-ethyl-5-propyl-N-[1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55333294 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 4-ethyl-5-propyl-N-[1-(4-sulfamoylphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | CCCc1sc(C(=O)NC(C)c2ccc(S(N)(=O)=O)cc2)cc1CC |
| InChI | InChI=1S/C18H24N2O3S2/c1-4-6-16-13(5-2)11-17(24-16)18(21)20-12(3)14-7-9-15(10-8-14)25(19,22)23/h7-12H,4-6H2,1-3H3,(H,20,21)(H2,19,22,23) |
| InChIKey | RRAQOZXYJIOIRY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |