C18H24N2O4S2 — CID 55389618
4-ethyl-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-propylthiophene-2-carboxamide (PubChem CID 55389618) has the molecular formula C18H24N2O4S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is 4-ethyl-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-propylthiophene-2-carboxamide.
| Compound Name | 4-ethyl-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55389618 |
| Molecular Formula | C18H24N2O4S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 4-ethyl-N-[4-[methoxy(methyl)sulfamoyl]phenyl]-5-propylthiophene-2-carboxamide |
| SMILES | CCCc1sc(C(=O)Nc2ccc(S(=O)(=O)N(C)OC)cc2)cc1CC |
| InChI | InChI=1S/C18H24N2O4S2/c1-5-7-16-13(6-2)12-17(25-16)18(21)19-14-8-10-15(11-9-14)26(22,23)20(3)24-4/h8-12H,5-7H2,1-4H3,(H,19,21) |
| InChIKey | PHXPAXJQJJGDEZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|