C17H22N2O4S2 — CID 9378750
4-ethyl-N-(4-methoxy-3-sulfamoylphenyl)-5-propylthiophene-2-carboxamide (PubChem CID 9378750) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-ethyl-N-(4-methoxy-3-sulfamoylphenyl)-5-propylthiophene-2-carboxamide.
| Compound Name | 4-ethyl-N-(4-methoxy-3-sulfamoylphenyl)-5-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 9378750 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-ethyl-N-(4-methoxy-3-sulfamoylphenyl)-5-propylthiophene-2-carboxamide |
| SMILES | CCCc1sc(C(=O)Nc2ccc(OC)c(S(N)(=O)=O)c2)cc1CC |
| InChI | InChI=1S/C17H22N2O4S2/c1-4-6-14-11(5-2)9-15(24-14)17(20)19-12-7-8-13(23-3)16(10-12)25(18,21)22/h7-10H,4-6H2,1-3H3,(H,19,20)(H2,18,21,22) |
| InChIKey | ZYXQLHXLGBTBSA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |