C9H13NO5S2 — CID 175413171
[4-(dimethylsulfamoyl)phenyl]methanesulfonic acid (PubChem CID 175413171) has the molecular formula C9H13NO5S2 and a molecular weight of 279.34 g/mol. Its IUPAC name is [4-(dimethylsulfamoyl)phenyl]methanesulfonic acid.
| Compound Name | [4-(dimethylsulfamoyl)phenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 175413171 |
| Molecular Formula | C9H13NO5S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | [4-(dimethylsulfamoyl)phenyl]methanesulfonic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(CS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H13NO5S2/c1-10(2)17(14,15)9-5-3-8(4-6-9)7-16(11,12)13/h3-6H,7H2,1-2H3,(H,11,12,13) |
| InChIKey | LFUQXCPYICBIPR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|