C13H21NO2S — CID 59667875
4-(2,2-dimethylpropyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 59667875) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-(2,2-dimethylpropyl)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 59667875 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CC(C)(C)C)cc1 |
| InChI | InChI=1S/C13H21NO2S/c1-13(2,3)10-11-6-8-12(9-7-11)17(15,16)14(4)5/h6-9H,10H2,1-5H3 |
| InChIKey | JOIGTTLLOBEFPR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |