C15H22N2O2S2 — CID 91662634
4-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylbenzenesulfonamide (PubChem CID 91662634) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is 4-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 91662634 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CSCCC(C)(C)C#N)cc1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-15(2,12-16)9-10-20-11-13-5-7-14(8-6-13)21(18,19)17(3)4/h5-8H,9-11H2,1-4H3 |
| InChIKey | GXKZVVANYWGTKP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|