C13H20N2O3S2 — CID 91662631
5-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylfuran-2-sulfonamide (PubChem CID 91662631) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylfuran-2-sulfonamide.
| Compound Name | 5-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 91662631 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-[(3-cyano-3-methylbutyl)sulfanylmethyl]-N,N-dimethylfuran-2-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CSCCC(C)(C)C#N)o1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-13(2,10-14)7-8-19-9-11-5-6-12(18-11)20(16,17)15(3)4/h5-6H,7-9H2,1-4H3 |
| InChIKey | NNLJRKSINMWLEA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|