About 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide
2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide (PubChem CID 120993056) has the molecular formula C15H23F2N3O2
and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide.
Molecular Properties
| Compound Name | 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide |
| PubChem CID | 120993056 |
| Molecular Formula | C15H23F2N3O2 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)N(CCN(C)C)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H23F2N3O2/c1-19(2)6-7-20(15(21)14(18)10-22-3)9-11-4-5-12(16)8-13(11)17/h4-5,8,14H,6-7,9-10,18H2,1-3H3 |
| InChIKey | CJWYKMDGLKKXOQ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide?
The IUPAC name of 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide (CID 120993056) is 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide.
What is the SMILES notation for 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide?
The canonical SMILES for 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide is COCC(N)C(=O)N(CCN(C)C)Cc1ccc(F)cc1F.
What is the InChIKey of 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide?
The InChIKey is CJWYKMDGLKKXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23F2N3O2/c1-19(2)6-7-20(15(21)14(18)10-22-3)9-11-4-5-12(16)8-13(11)17/h4-5,8,14H,6-7,9-10,18H2,1-3H3.
What are the key properties of 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide?
2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide has a molecular weight of 315.36 g/mol, XLogP of 0.83, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[(2,4-difluorophenyl)methyl]-N-[2-(dimethylamino)ethyl]-3-methoxypropanamide is sourced from PubChem (CID 120993056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).