C15H22ClFN2O2 — CID 119320684
2-amino-N-[(2-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)pentanamide (PubChem CID 119320684) has the molecular formula C15H22ClFN2O2 and a molecular weight of 316.80 g/mol. Its IUPAC name is 2-amino-N-[(2-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)pentanamide.
| Compound Name | 2-amino-N-[(2-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)pentanamide |
|---|---|
| PubChem CID | 119320684 |
| Molecular Formula | C15H22ClFN2O2 |
| Molecular Weight | 316.80 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-amino-N-[(2-chloro-4-fluorophenyl)methyl]-N-(2-methoxyethyl)pentanamide |
| SMILES | CCCC(N)C(=O)N(CCOC)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H22ClFN2O2/c1-3-4-14(18)15(20)19(7-8-21-2)10-11-5-6-12(17)9-13(11)16/h5-6,9,14H,3-4,7-8,10,18H2,1-2H3 |
| InChIKey | HTUWJUHFJWHMAM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.80 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |