C36H41N3O6S — CID 24795272
methyl (2S)-3-methyl-2-[[(Z)-2-[[(2S)-2-(prop-2-enoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]butanoate (PubChem CID 24795272) has the molecular formula C36H41N3O6S and a molecular weight of 643.81 g/mol. Its IUPAC name is methyl (2S)-3-methyl-2-[[(Z)-2-[[(2S)-2-(prop-2-enoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]butanoate.
| Compound Name | methyl (2S)-3-methyl-2-[[(Z)-2-[[(2S)-2-(prop-2-enoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 24795272 |
| Molecular Formula | C36H41N3O6S |
| Molecular Weight | 643.81 g/mol |
| Exact Mass | 643.27 |
| IUPAC Name | methyl (2S)-3-methyl-2-[[(Z)-2-[[(2S)-2-(prop-2-enoxycarbonylamino)-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]butanoate |
| SMILES | C=CCOC(=O)N[C@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)N/C(=C\C)C(=O)N[C@H](C(=O)OC)C(C)C |
| InChI | InChI=1S/C36H41N3O6S/c1-6-23-45-35(43)38-30(33(41)37-29(7-2)32(40)39-31(25(3)4)34(42)44-5)24-46-36(26-17-11-8-12-18-26,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h6-22,25,30-31H,1,23-24H2,2-5H3,(H,37,41)(H,38,43)(H,39,40)/b29-7-/t30-,31+/m1/s1 |
| InChIKey | OZYLDGSWGUFVLN-BVGZHOGXSA-N |
| XLogP | 5.33 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.81 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|