C37H46N4O5S — CID 11767508
methyl (2S)-2-[[(Z)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]-3-methylbutanoate (PubChem CID 11767508) has the molecular formula C37H46N4O5S and a molecular weight of 658.87 g/mol. Its IUPAC name is methyl (2S)-2-[[(Z)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(Z)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 11767508 |
| Molecular Formula | C37H46N4O5S |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | methyl (2S)-2-[[(Z)-2-[[(2S)-2-[[(2R)-2-amino-3-methylbutanoyl]amino]-3-tritylsulfanylpropanoyl]amino]but-2-enoyl]amino]-3-methylbutanoate |
| SMILES | C/C=C(\NC(=O)[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)[C@H](N)C(C)C)C(=O)N[C@H](C(=O)OC)C(C)C |
| InChI | InChI=1S/C37H46N4O5S/c1-7-29(33(42)41-32(25(4)5)36(45)46-6)39-34(43)30(40-35(44)31(38)24(2)3)23-47-37(26-17-11-8-12-18-26,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h7-22,24-25,30-32H,23,38H2,1-6H3,(H,39,43)(H,40,44)(H,41,42)/b29-7-/t30-,31-,32+/m1/s1 |
| InChIKey | RGBDURTWMYFVBO-PLYWUDRUSA-N |
| XLogP | 4.51 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|