C11H23NO5S — CID 131881761
[(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl] methanesulfonate (PubChem CID 131881761) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is [(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 131881761 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | [(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-3-yl] methanesulfonate |
| SMILES | CC[C@H](OS(C)(=O)=O)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO5S/c1-7-9(17-18(6,14)15)8(2)12-10(13)16-11(3,4)5/h8-9H,7H2,1-6H3,(H,12,13)/t8-,9+/m1/s1 |
| InChIKey | LXLDGAJEELSFQG-BDAKNGLRSA-N |
| XLogP | 1.65 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|