C28H46O4Si — CID 14081627
ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenoate (PubChem CID 14081627) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenoate.
| Compound Name | ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 14081627 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | ethyl (2E,4E,6E,8E,10E,12E,14S,15R,16S,17S)-15-[tert-butyl(dimethyl)silyl]oxy-17-hydroxy-14,16-dimethyloctadeca-2,4,6,8,10,12-hexaenoate |
| SMILES | CCOC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C28H46O4Si/c1-10-31-26(30)22-20-18-16-14-12-11-13-15-17-19-21-23(2)27(24(3)25(4)29)32-33(8,9)28(5,6)7/h11-25,27,29H,10H2,1-9H3/b13-11+,14-12+,17-15+,18-16+,21-19+,22-20+/t23-,24-,25-,27+/m0/s1 |
| InChIKey | IURJFKMZZNBEFE-HVUUYZEHSA-N |
| XLogP | 6.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|