C21H27NO2 — CID 46868747
(2R)-2-phenyl-2-[[(2S,3S)-3-(phenylmethoxymethyl)pent-4-en-2-yl]amino]ethanol (PubChem CID 46868747) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[[(2S,3S)-3-(phenylmethoxymethyl)pent-4-en-2-yl]amino]ethanol.
| Compound Name | (2R)-2-phenyl-2-[[(2S,3S)-3-(phenylmethoxymethyl)pent-4-en-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 46868747 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (2R)-2-phenyl-2-[[(2S,3S)-3-(phenylmethoxymethyl)pent-4-en-2-yl]amino]ethanol |
| SMILES | C=C[C@H](COCc1ccccc1)[C@H](C)N[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-3-19(16-24-15-18-10-6-4-7-11-18)17(2)22-21(14-23)20-12-8-5-9-13-20/h3-13,17,19,21-23H,1,14-16H2,2H3/t17-,19+,21-/m0/s1 |
| InChIKey | UVWAEAXDRNAKKS-DSKINZAPSA-N |
| XLogP | 3.72 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|