C29H46O3Si2 — CID 134881253
tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[(E)-2-phenylethenoxy]propoxy]-dimethylsilane (PubChem CID 134881253) has the molecular formula C29H46O3Si2 and a molecular weight of 498.86 g/mol. Its IUPAC name is tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[(E)-2-phenylethenoxy]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[(E)-2-phenylethenoxy]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134881253 |
| Molecular Formula | C29H46O3Si2 |
| Molecular Weight | 498.86 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | tert-butyl-[3-[tert-butyl(dimethyl)silyl]oxy-1-phenyl-2-[(E)-2-phenylethenoxy]propoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC(O/C=C/c1ccccc1)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C29H46O3Si2/c1-28(2,3)33(7,8)31-23-26(30-22-21-24-17-13-11-14-18-24)27(25-19-15-12-16-20-25)32-34(9,10)29(4,5)6/h11-22,26-27H,23H2,1-10H3/b22-21+ |
| InChIKey | LVWIJUWGDRJOKI-QURGRASLSA-N |
| XLogP | 8.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.86 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|