C18H39NO2Si2 — CID 89366790
2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[hydroxy(dimethyl)silyl]-6-methylheptanenitrile (PubChem CID 89366790) has the molecular formula C18H39NO2Si2 and a molecular weight of 357.69 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[hydroxy(dimethyl)silyl]-6-methylheptanenitrile.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[hydroxy(dimethyl)silyl]-6-methylheptanenitrile |
|---|---|
| PubChem CID | 89366790 |
| Molecular Formula | C18H39NO2Si2 |
| Molecular Weight | 357.69 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-6-[hydroxy(dimethyl)silyl]-6-methylheptanenitrile |
| SMILES | CC(C)(CCCC(C#N)CCO[Si](C)(C)C(C)(C)C)[Si](C)(C)O |
| InChI | InChI=1S/C18H39NO2Si2/c1-17(2,3)23(8,9)21-14-12-16(15-19)11-10-13-18(4,5)22(6,7)20/h16,20H,10-14H2,1-9H3 |
| InChIKey | DMMMATWQDBVFOK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.69 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|