C12H22Cl3NO2Si — CID 134859214
[(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 134859214) has the molecular formula C12H22Cl3NO2Si and a molecular weight of 346.76 g/mol. Its IUPAC name is [(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 134859214 |
| Molecular Formula | C12H22Cl3NO2Si |
| Molecular Weight | 346.76 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [(2S)-1-[tert-butyl(dimethyl)silyl]oxybut-3-en-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/O[C@@H](C=C)CO[Si](C)(C)C(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H22Cl3NO2Si/c1-7-9(18-10(16)12(13,14)15)8-17-19(5,6)11(2,3)4/h7,9,16H,1,8H2,2-6H3/b16-10+/t9-/m0/s1 |
| InChIKey | WMUFCEZJYSGDJX-RKMZRFOKSA-N |
| XLogP | 4.93 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|