C15H30Cl3NO2Si2 — CID 101134026
[(Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-enyl] 2,2,2-trichloroethanimidate (PubChem CID 101134026) has the molecular formula C15H30Cl3NO2Si2 and a molecular weight of 418.94 g/mol. Its IUPAC name is [(Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 101134026 |
| Molecular Formula | C15H30Cl3NO2Si2 |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [(Z,2S)-2-[tert-butyl(dimethyl)silyl]oxy-4-trimethylsilylbut-3-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC[C@H](/C=C\[Si](C)(C)C)O[Si](C)(C)C(C)(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H30Cl3NO2Si2/c1-14(2,3)23(7,8)21-12(9-10-22(4,5)6)11-20-13(19)15(16,17)18/h9-10,12,19H,11H2,1-8H3/b10-9-,19-13+/t12-/m0/s1 |
| InChIKey | QULJELNXUQKJLW-ULARVIDKSA-N |
| XLogP | 6.17 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|