C28H36O4Si — CID 11070636
1-[(2R)-2-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]but-3-yn-2-yl]oxypropan-2-one (PubChem CID 11070636) has the molecular formula C28H36O4Si and a molecular weight of 464.68 g/mol. Its IUPAC name is 1-[(2R)-2-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]but-3-yn-2-yl]oxypropan-2-one.
| Compound Name | 1-[(2R)-2-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]but-3-yn-2-yl]oxypropan-2-one |
|---|---|
| PubChem CID | 11070636 |
| Molecular Formula | C28H36O4Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 1-[(2R)-2-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]but-3-yn-2-yl]oxypropan-2-one |
| SMILES | C#C[C@@](C)(OCC(C)=O)[C@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O1 |
| InChI | InChI=1S/C28H36O4Si/c1-7-28(6,30-20-22(2)29)26-19-18-23(32-26)21-31-33(27(3,4)5,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h1,8-17,23,26H,18-21H2,2-6H3/t23-,26+,28+/m0/s1 |
| InChIKey | OPZKSYJDYWDWIJ-DANFDKMISA-N |
| XLogP | 4.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|