C27H28O3Si — CID 101197118
(2S)-2-[(2R,5S)-5-(triphenylsilyloxymethyl)oxolan-2-yl]but-3-yn-2-ol (PubChem CID 101197118) has the molecular formula C27H28O3Si and a molecular weight of 428.60 g/mol. Its IUPAC name is (2S)-2-[(2R,5S)-5-(triphenylsilyloxymethyl)oxolan-2-yl]but-3-yn-2-ol.
| Compound Name | (2S)-2-[(2R,5S)-5-(triphenylsilyloxymethyl)oxolan-2-yl]but-3-yn-2-ol |
|---|---|
| PubChem CID | 101197118 |
| Molecular Formula | C27H28O3Si |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | (2S)-2-[(2R,5S)-5-(triphenylsilyloxymethyl)oxolan-2-yl]but-3-yn-2-ol |
| SMILES | C#C[C@](C)(O)[C@H]1CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C27H28O3Si/c1-3-27(2,28)26-20-19-22(30-26)21-29-31(23-13-7-4-8-14-23,24-15-9-5-10-16-24)25-17-11-6-12-18-25/h1,4-18,22,26,28H,19-21H2,2H3/t22-,26+,27-/m0/s1 |
| InChIKey | PKBHFYRGRPLNGQ-FDJWOJMMSA-N |
| XLogP | 2.60 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|