C30H41NO3Si — CID 11179373
3-[4-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-5-yl]butyl]pentane-2,4-dione (PubChem CID 11179373) has the molecular formula C30H41NO3Si and a molecular weight of 491.75 g/mol. Its IUPAC name is 3-[4-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-5-yl]butyl]pentane-2,4-dione.
| Compound Name | 3-[4-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-5-yl]butyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 11179373 |
| Molecular Formula | C30H41NO3Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 3-[4-[(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyrrol-5-yl]butyl]pentane-2,4-dione |
| SMILES | CC(=O)C(CCCCC1=N[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC1)C(C)=O |
| InChI | InChI=1S/C30H41NO3Si/c1-23(32)29(24(2)33)19-13-12-14-25-20-21-26(31-25)22-34-35(30(3,4)5,27-15-8-6-9-16-27)28-17-10-7-11-18-28/h6-11,15-18,26,29H,12-14,19-22H2,1-5H3/t26-/m0/s1 |
| InChIKey | ULUGRYODPFSQEY-SANMLTNESA-N |
| XLogP | 5.52 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|