C25H37N4OSi+ — CID 73101123
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methanamine (PubChem CID 73101123) has the molecular formula C25H37N4OSi+ and a molecular weight of 437.68 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methanamine.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methanamine |
|---|---|
| PubChem CID | 73101123 |
| Molecular Formula | C25H37N4OSi+ |
| Molecular Weight | 437.68 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-8-yl]methanamine |
| SMILES | CC(C)(C)[Si](OCC1CC[N+]2=C(NC(CN)CC2)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H36N4OSi/c1-25(2,3)31(22-10-6-4-7-11-22,23-12-8-5-9-13-23)30-19-21-15-17-29-16-14-20(18-26)27-24(29)28-21/h4-13,20-21H,14-19,26H2,1-3H3,(H,27,28)/p+1 |
| InChIKey | RWQVKAJTOPHZMS-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.68 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|