C41H54N3O2Si2+ — CID 24787035
tert-butyl-[[(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-6-yl]methoxy]-diphenylsilane (PubChem CID 24787035) has the molecular formula C41H54N3O2Si2+ and a molecular weight of 677.07 g/mol. Its IUPAC name is tert-butyl-[[(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-6-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-6-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 24787035 |
| Molecular Formula | C41H54N3O2Si2+ |
| Molecular Weight | 677.07 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | tert-butyl-[[(2S,6S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,2,3,4,6,7,8,9-octahydropyrimido[1,2-a]pyrimidin-5-ium-6-yl]methoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OC[C@@H]1CC[N+]2=C(NCC[C@H]2CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H53N3O2Si2/c1-40(2,3)47(35-19-11-7-12-20-35,36-21-13-8-14-22-36)45-31-33-28-30-44-34(27-29-42-39(44)43-33)32-46-48(41(4,5)6,37-23-15-9-16-24-37)38-25-17-10-18-26-38/h7-26,33-34H,27-32H2,1-6H3,(H,42,43)/p+1/t33-,34-/m0/s1 |
| InChIKey | NQUBAFZTYAMYJW-HEVIKAOCSA-O |
| XLogP | 5.23 |
| TPSA | 45.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.07 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|