C28H35N3O6Si — CID 10530443
1-[(2R,3R,4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-5-[(methylideneamino)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10530443) has the molecular formula C28H35N3O6Si and a molecular weight of 537.69 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-5-[(methylideneamino)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-5-[(methylideneamino)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10530443 |
| Molecular Formula | C28H35N3O6Si |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-4-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-5-[(methylideneamino)oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=NOC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)[C@H](OC)[C@@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H35N3O6Si/c1-19-17-31(27(33)30-25(19)32)26-24(34-6)23(22(36-26)18-35-29-5)37-38(28(2,3)4,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-17,22-24,26H,5,18H2,1-4,6H3,(H,30,32,33)/t22-,23-,24-,26-/m1/s1 |
| InChIKey | SRQZJKZNZXRKBS-PMHJDTQVSA-N |
| XLogP | 2.33 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|