C15H16O6S — CID 90901023
4-methyl-7-[(3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxychromen-2-one (PubChem CID 90901023) has the molecular formula C15H16O6S and a molecular weight of 324.35 g/mol. Its IUPAC name is 4-methyl-7-[(3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxychromen-2-one.
| Compound Name | 4-methyl-7-[(3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 90901023 |
| Molecular Formula | C15H16O6S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 4-methyl-7-[(3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxychromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OC3SC[C@@H](O)[C@H](O)[C@H]3O)ccc12 |
| InChI | InChI=1S/C15H16O6S/c1-7-4-12(17)21-11-5-8(2-3-9(7)11)20-15-14(19)13(18)10(16)6-22-15/h2-5,10,13-16,18-19H,6H2,1H3/t10-,13+,14-,15?/m1/s1 |
| InChIKey | JRHNIQQUVJOPQC-JPMCUGQXSA-N |
| XLogP | 0.64 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|