C25H32N2O9S — CID 87878058
[(2R,3R,4S,5S)-5-acetyloxy-3-[2-(dimethylamino)acetyl]oxy-2-(4-methyl-2-oxochromen-7-yl)oxythian-4-yl] 2-(dimethylamino)acetate (PubChem CID 87878058) has the molecular formula C25H32N2O9S and a molecular weight of 536.60 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-acetyloxy-3-[2-(dimethylamino)acetyl]oxy-2-(4-methyl-2-oxochromen-7-yl)oxythian-4-yl] 2-(dimethylamino)acetate.
| Compound Name | [(2R,3R,4S,5S)-5-acetyloxy-3-[2-(dimethylamino)acetyl]oxy-2-(4-methyl-2-oxochromen-7-yl)oxythian-4-yl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 87878058 |
| Molecular Formula | C25H32N2O9S |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | [(2R,3R,4S,5S)-5-acetyloxy-3-[2-(dimethylamino)acetyl]oxy-2-(4-methyl-2-oxochromen-7-yl)oxythian-4-yl] 2-(dimethylamino)acetate |
| SMILES | CC(=O)O[C@@H]1CS[C@@H](Oc2ccc3c(C)cc(=O)oc3c2)[C@H](OC(=O)CN(C)C)[C@H]1OC(=O)CN(C)C |
| InChI | InChI=1S/C25H32N2O9S/c1-14-9-20(29)34-18-10-16(7-8-17(14)18)33-25-24(36-22(31)12-27(5)6)23(35-21(30)11-26(3)4)19(13-37-25)32-15(2)28/h7-10,19,23-25H,11-13H2,1-6H3/t19-,23+,24-,25-/m1/s1 |
| InChIKey | MZMPJKNDXLMRAI-HEGQMBHGSA-N |
| XLogP | 1.43 |
| TPSA | 124.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|