C15H16O4S — CID 142894149
7-(4-hydroxythian-2-yl)oxy-4-methylchromen-2-one (PubChem CID 142894149) has the molecular formula C15H16O4S and a molecular weight of 292.36 g/mol. Its IUPAC name is 7-(4-hydroxythian-2-yl)oxy-4-methylchromen-2-one.
| Compound Name | 7-(4-hydroxythian-2-yl)oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 142894149 |
| Molecular Formula | C15H16O4S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 7-(4-hydroxythian-2-yl)oxy-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OC3CC(O)CCS3)ccc12 |
| InChI | InChI=1S/C15H16O4S/c1-9-6-14(17)19-13-8-11(2-3-12(9)13)18-15-7-10(16)4-5-20-15/h2-3,6,8,10,15-16H,4-5,7H2,1H3 |
| InChIKey | HKIOPNBVOVDWCF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|