About (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate
(4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate (PubChem CID 75459738) has the molecular formula C21H22O4
and a molecular weight of 338.40 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate.
Molecular Properties
| Compound Name | (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate |
| PubChem CID | 75459738 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)C3C4CC5CC(C4)CC3C5)ccc12 |
| InChI | InChI=1S/C21H22O4/c1-11-4-19(22)25-18-10-16(2-3-17(11)18)24-21(23)20-14-6-12-5-13(8-14)9-15(20)7-12/h2-4,10,12-15,20H,5-9H2,1H3 |
| InChIKey | VDLSZAXHEFXFAR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate?
The IUPAC name of (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate (CID 75459738) is (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate.
What is the SMILES notation for (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate?
The canonical SMILES for (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate is Cc1cc(=O)oc2cc(OC(=O)C3C4CC5CC(C4)CC3C5)ccc12.
What is the InChIKey of (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate?
The InChIKey is VDLSZAXHEFXFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O4/c1-11-4-19(22)25-18-10-16(2-3-17(11)18)24-21(23)20-14-6-12-5-13(8-14)9-15(20)7-12/h2-4,10,12-15,20H,5-9H2,1H3.
What are the key properties of (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate?
(4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate has a molecular weight of 338.40 g/mol, XLogP of 4.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-2-oxochromen-7-yl) adamantane-2-carboxylate is sourced from PubChem (CID 75459738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).