C15H16ClNO4 — CID 52993282
(4-methyl-2-oxochromen-7-yl) (2R)-pyrrolidine-2-carboxylate;hydrochloride (PubChem CID 52993282) has the molecular formula C15H16ClNO4 and a molecular weight of 309.75 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) (2R)-pyrrolidine-2-carboxylate;hydrochloride.
| Compound Name | (4-methyl-2-oxochromen-7-yl) (2R)-pyrrolidine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 52993282 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) (2R)-pyrrolidine-2-carboxylate;hydrochloride |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)[C@H]3CCCN3)ccc12.Cl |
| InChI | InChI=1S/C15H15NO4.ClH/c1-9-7-14(17)20-13-8-10(4-5-11(9)13)19-15(18)12-3-2-6-16-12;/h4-5,7-8,12,16H,2-3,6H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | NZJDJIRXQJDPIN-UTONKHPSSA-N |
| XLogP | 2.18 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|