C27H20O8S2 — CID 71945472
bis(4-methylphenyl) 6-oxobenzo[c]chromene-3,8-disulfonate (PubChem CID 71945472) has the molecular formula C27H20O8S2 and a molecular weight of 536.58 g/mol. Its IUPAC name is bis(4-methylphenyl) 6-oxobenzo[c]chromene-3,8-disulfonate.
| Compound Name | bis(4-methylphenyl) 6-oxobenzo[c]chromene-3,8-disulfonate |
|---|---|
| PubChem CID | 71945472 |
| Molecular Formula | C27H20O8S2 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.06 |
| IUPAC Name | bis(4-methylphenyl) 6-oxobenzo[c]chromene-3,8-disulfonate |
| SMILES | Cc1ccc(OS(=O)(=O)c2ccc3c(c2)oc(=O)c2cc(S(=O)(=O)Oc4ccc(C)cc4)ccc23)cc1 |
| InChI | InChI=1S/C27H20O8S2/c1-17-3-7-19(8-4-17)34-36(29,30)21-11-13-23-24-14-12-22(16-26(24)33-27(28)25(23)15-21)37(31,32)35-20-9-5-18(2)6-10-20/h3-16H,1-2H3 |
| InChIKey | QWWBUUIJGDLEMP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 116.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|