C17H13NO7S — CID 10339427
(3,4-dimethyl-2-oxochromen-7-yl) 4-nitrobenzenesulfonate (PubChem CID 10339427) has the molecular formula C17H13NO7S and a molecular weight of 375.36 g/mol. Its IUPAC name is (3,4-dimethyl-2-oxochromen-7-yl) 4-nitrobenzenesulfonate.
| Compound Name | (3,4-dimethyl-2-oxochromen-7-yl) 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 10339427 |
| Molecular Formula | C17H13NO7S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | (3,4-dimethyl-2-oxochromen-7-yl) 4-nitrobenzenesulfonate |
| SMILES | Cc1c(C)c2ccc(OS(=O)(=O)c3ccc([N+](=O)[O-])cc3)cc2oc1=O |
| InChI | InChI=1S/C17H13NO7S/c1-10-11(2)17(19)24-16-9-13(5-8-15(10)16)25-26(22,23)14-6-3-12(4-7-14)18(20)21/h3-9H,1-2H3 |
| InChIKey | IDMZEPFANZTGIU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|