C20H18O6S — CID 24979814
(4-methyl-2-oxochromen-7-yl) 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 24979814) has the molecular formula C20H18O6S and a molecular weight of 386.43 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 24979814 |
| Molecular Formula | C20H18O6S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)Oc2ccc3c(C)cc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C20H18O6S/c1-13-3-6-16(7-4-13)27(23,24)10-9-19(21)25-15-5-8-17-14(2)11-20(22)26-18(17)12-15/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | HOJFTPJDKKWJOJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|