C26H22O6 — CID 18870497
(4-methyl-2-oxochromen-7-yl) 2-[4-(3,5-dimethylphenoxy)phenoxy]acetate (PubChem CID 18870497) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 2-[4-(3,5-dimethylphenoxy)phenoxy]acetate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 2-[4-(3,5-dimethylphenoxy)phenoxy]acetate |
|---|---|
| PubChem CID | 18870497 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 2-[4-(3,5-dimethylphenoxy)phenoxy]acetate |
| SMILES | Cc1cc(C)cc(Oc2ccc(OCC(=O)Oc3ccc4c(C)cc(=O)oc4c3)cc2)c1 |
| InChI | InChI=1S/C26H22O6/c1-16-10-17(2)12-22(11-16)30-20-6-4-19(5-7-20)29-15-26(28)31-21-8-9-23-18(3)13-25(27)32-24(23)14-21/h4-14H,15H2,1-3H3 |
| InChIKey | CLIOFFDXDBYLSL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|