C27H24ClNO6S — CID 2424162
(4-methyl-2-oxochromen-7-yl) 3-(N-(4-chlorophenyl)sulfonyl-3,5-dimethylanilino)propanoate (PubChem CID 2424162) has the molecular formula C27H24ClNO6S and a molecular weight of 526.01 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 3-(N-(4-chlorophenyl)sulfonyl-3,5-dimethylanilino)propanoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 3-(N-(4-chlorophenyl)sulfonyl-3,5-dimethylanilino)propanoate |
|---|---|
| PubChem CID | 2424162 |
| Molecular Formula | C27H24ClNO6S |
| Molecular Weight | 526.01 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 3-(N-(4-chlorophenyl)sulfonyl-3,5-dimethylanilino)propanoate |
| SMILES | Cc1cc(C)cc(N(CCC(=O)Oc2ccc3c(C)cc(=O)oc3c2)S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H24ClNO6S/c1-17-12-18(2)14-21(13-17)29(36(32,33)23-7-4-20(28)5-8-23)11-10-26(30)34-22-6-9-24-19(3)15-27(31)35-25(24)16-22/h4-9,12-16H,10-11H2,1-3H3 |
| InChIKey | ZXSPNRJBTVKWCL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.01 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|