C24H24O6 — CID 57410722
(4-methyl-2-oxochromen-7-yl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate (PubChem CID 57410722) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
|---|---|
| PubChem CID | 57410722 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 3-methyl-3-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)butanoate |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(=O)Oc2ccc3c(C)cc(=O)oc3c2)=C(C)C1=O |
| InChI | InChI=1S/C24H24O6/c1-12-9-19(25)30-18-10-16(7-8-17(12)18)29-20(26)11-24(5,6)21-15(4)22(27)13(2)14(3)23(21)28/h7-10H,11H2,1-6H3 |
| InChIKey | PDTDIMIDWCSOMK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|