C26H26ClNO3 — CID 122180434
7-[[4-[[benzyl(methyl)amino]methyl]phenyl]methoxy]-4-methylchromen-2-one;hydrochloride (PubChem CID 122180434) has the molecular formula C26H26ClNO3 and a molecular weight of 435.95 g/mol. Its IUPAC name is 7-[[4-[[benzyl(methyl)amino]methyl]phenyl]methoxy]-4-methylchromen-2-one;hydrochloride.
| Compound Name | 7-[[4-[[benzyl(methyl)amino]methyl]phenyl]methoxy]-4-methylchromen-2-one;hydrochloride |
|---|---|
| PubChem CID | 122180434 |
| Molecular Formula | C26H26ClNO3 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 7-[[4-[[benzyl(methyl)amino]methyl]phenyl]methoxy]-4-methylchromen-2-one;hydrochloride |
| SMILES | Cc1cc(=O)oc2cc(OCc3ccc(CN(C)Cc4ccccc4)cc3)ccc12.Cl |
| InChI | InChI=1S/C26H25NO3.ClH/c1-19-14-26(28)30-25-15-23(12-13-24(19)25)29-18-22-10-8-21(9-11-22)17-27(2)16-20-6-4-3-5-7-20;/h3-15H,16-18H2,1-2H3;1H |
| InChIKey | GDOQYXLNAKCFNO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|