C24H21NO4S — CID 27742540
N-methyl-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 27742540) has the molecular formula C24H21NO4S and a molecular weight of 419.50 g/mol. Its IUPAC name is N-methyl-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-methyl-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 27742540 |
| Molecular Formula | C24H21NO4S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N-methyl-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | Cc1cc(=O)oc2cc(OCc3ccc(C(=O)N(C)Cc4ccsc4)cc3)ccc12 |
| InChI | InChI=1S/C24H21NO4S/c1-16-11-23(26)29-22-12-20(7-8-21(16)22)28-14-17-3-5-19(6-4-17)24(27)25(2)13-18-9-10-30-15-18/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | QEVWRHOKXZPMFI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|