C28H27NO6 — CID 16551304
N-(3,4-diethoxyphenyl)-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzamide (PubChem CID 16551304) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is N-(3,4-diethoxyphenyl)-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzamide.
| Compound Name | N-(3,4-diethoxyphenyl)-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzamide |
|---|---|
| PubChem CID | 16551304 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-(3,4-diethoxyphenyl)-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(COc3ccc4c(C)cc(=O)oc4c3)cc2)cc1OCC |
| InChI | InChI=1S/C28H27NO6/c1-4-32-24-13-10-21(15-26(24)33-5-2)29-28(31)20-8-6-19(7-9-20)17-34-22-11-12-23-18(3)14-27(30)35-25(23)16-22/h6-16H,4-5,17H2,1-3H3,(H,29,31) |
| InChIKey | LKMULHHASVPTJB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|