C27H23FN2O6 — CID 43003010
N'-[2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzohydrazide (PubChem CID 43003010) has the molecular formula C27H23FN2O6 and a molecular weight of 490.49 g/mol. Its IUPAC name is N'-[2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzohydrazide.
| Compound Name | N'-[2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzohydrazide |
|---|---|
| PubChem CID | 43003010 |
| Molecular Formula | C27H23FN2O6 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | N'-[2-(2-fluorophenoxy)propanoyl]-4-[(4-methyl-2-oxochromen-7-yl)oxymethyl]benzohydrazide |
| SMILES | Cc1cc(=O)oc2cc(OCc3ccc(C(=O)NNC(=O)C(C)Oc4ccccc4F)cc3)ccc12 |
| InChI | InChI=1S/C27H23FN2O6/c1-16-13-25(31)36-24-14-20(11-12-21(16)24)34-15-18-7-9-19(10-8-18)27(33)30-29-26(32)17(2)35-23-6-4-3-5-22(23)28/h3-14,17H,15H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | XSZZIUYPQXUSNL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|